CAS 652160-72-0

2-bromo-5-fluoro-3-nitropyridine

Description:

2-Bromo-5-fluoro-3-nitropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom at the 2-position, a fluorine atom at the 5-position, and a nitro group at the 3-position. This compound typically appears as a yellow to brown solid and is soluble in organic solvents. Its molecular structure contributes to its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The presence of the nitro group enhances its electrophilic character, while the halogen substituents can facilitate further reactions such as nucleophilic substitutions. Additionally, the compound's unique combination of functional groups may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2-bromo-5-fluoro-3-nitropyridine is a valuable compound in synthetic organic chemistry with potential applications in various fields.

Formula: C₅H₂BrFN₂O₂

InChI: InChI=1/C5H2BrFN2O2/c6-5-4(9(10)11)1-3(7)2-8-5/h1-2H

SMILES: c1c(cnc(c1N(=O)=O)Br)F

Synonyms:

• 2-Bromo-5-fluoro-2-nitropyrdine
• Pyridine, 2-Bromo-5-Fluoro-3-Nitro-

2-Bromo-5-fluoro-3-nitropyridine

CAS: 652160-72-0

Formula: C₅H₂BrFN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 220.9840

Ref: IN-DA00ECOX

2-Bromo-5-fluoro-3-nitropyridine

CAS: 652160-72-0

2-Bromo-5-fluoro-3-nitropyridine

Purity: 98%

Color and Shape: Pale Orange Solid

Molecular weight: 220.98g/mol

Ref: 54-PC400737

2-Bromo-5-fluoro-3-nitropyridine

CAS: 652160-72-0

Formula: C₅H₂BrFN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 220.985

Ref: 10-F078018