CAS 6523-49-5
:4-(1H-1,2,4-triazol-1-yl)aniline
Description:
4-(1H-1,2,4-triazol-1-yl)aniline, with the CAS number 6523-49-5, is an organic compound characterized by its triazole and aniline functional groups. This compound features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms, and an aniline moiety, which consists of an amino group attached to a phenyl ring. The presence of the triazole group imparts unique chemical properties, including potential for coordination with metal ions and biological activity, making it of interest in pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its synthesis often involves reactions that form the triazole ring, followed by substitution reactions to introduce the aniline component. The compound's reactivity can be influenced by the electron-donating nature of the amino group and the electron-withdrawing characteristics of the triazole, which can affect its interactions in various chemical environments.
Formula:C8H8N4
InChI:InChI=1/C8H8N4/c9-7-1-3-8(4-2-7)12-6-10-5-11-12/h1-6H,9H2
SMILES:c1cc(ccc1N)n1cncn1
Synonyms:- 1-(4'-Aminophenyl)-1,2,4-Triazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(1,2,4-Triazol-1-yl)aniline
CAS:Formula:C8H8N4Purity:>98.0%(GC)(T)Color and Shape:White to Gray to Red powder to crystalMolecular weight:160.181-(4'-AMINOPHENYL)-1,2,4-TRIAZOLE
CAS:Formula:C8H8N4Purity:97%Color and Shape:SolidMolecular weight:160.17591-(4-Aminophenyl)-1,2,4-triazole
CAS:1-(4-Aminophenyl)-1,2,4-triazolePurity:95Color and Shape:SolidMolecular weight:160.18g/mol1-(4′-Aminophenyl)-1,2,4-triazole
CAS:Formula:C8H8N4Purity:97%Color and Shape:Solid, Beige powderMolecular weight:160.184-(1H-1,2,4-Triazol-1-yl)aniline
CAS:Triazolylaniline is a carbonyl, sulfate, alkali metal, centroid, and residue. It is used in the production of animals and c1-4 alkyl. This substance has antiviral agents that are transferable to triazole and haloalkyl. Triazolylaniline can be found in phenyl groups. It is also sustainable because it does not contain any heavy metals or toxic chemicals.
Formula:C8H8N4Purity:Min. 95%Color and Shape:PowderMolecular weight:160.18 g/mol




