CAS 65236-62-6

1-ethenyl-4,8-dimethoxy-9H-beta-carboline

Description:

1-Ethenyl-4,8-dimethoxy-9H-beta-carboline, with the CAS number 65236-62-6, is a chemical compound belonging to the beta-carboline family, which is characterized by a fused indole and pyridine structure. This compound features a vinyl group at the 1-position and two methoxy groups at the 4 and 8 positions of the beta-carboline core. Beta-carbolines are known for their diverse biological activities, including potential neuroprotective, antidepressant, and anti-cancer properties. The presence of methoxy groups can influence the compound's solubility, stability, and reactivity, potentially enhancing its pharmacological profile. Additionally, the ethenyl group may contribute to the compound's ability to participate in various chemical reactions, such as polymerization or cross-linking. Overall, 1-ethenyl-4,8-dimethoxy-9H-beta-carboline represents a structurally interesting molecule with potential applications in medicinal chemistry and pharmacology, although specific studies on its properties and activities may be limited.

Formula: C₁₅H₁₄N₂O₂

InChI: InChI=1/C15H14N2O2/c1-4-10-15-13(12(19-3)8-16-10)9-6-5-7-11(18-2)14(9)17-15/h4-8,17H,1H2,2-3H3

SMILES: C=Cc1c2c(c3cccc(c3[nH]2)OC)c(cn1)OC

Synonyms:

• 4,8-Dimethoxy-1-vinyl-9H-beta-carboline
• 9H-pyrido[3,4-b]indole, 1-ethenyl-4,8-dimethoxy-

Dehydrocrenatidine

CAS: 65236-62-6

Formula: C₁₅H₁₄N₂O₂

Molecular weight: 254.2839

Ref: IN-DA00EGU7

Dehydrocrenatidine

CAS: 65236-62-6

Formula: C₁₅H₁₄N₂O₂

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 254.289

Ref: BP-SBP00603

Dehydrocrenatidine

CAS: 65236-62-6

Dehydrocrenatidine is a naturally occurring alkaloid, which is derived from certain plant species. This compound is isolated from the roots of Crenata plants and exhibits notable biological activity. Dehydrocrenatidine functions primarily through the inhibition of specific cellular pathways, disrupting processes crucial to cell proliferation and survival. This mechanism of action positions it as a promising candidate for therapeutic applications in oncology.

Formula: C₁₅H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 254.28 g/mol

Ref: 3D-QCA23662

Dehydrocrenatidine

CAS: 65236-62-6

Dehydrocrenatidine (Kumujian G) is an inhibitor of JAK and induces cell apoptosis.

Formula: C₁₅H₁₄N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.28

Ref: TM-T19934