CAS 65240-86-0

N-(1,4-dioxo-1,4-dihydronaphthalen-2-yl)benzamide

Description:

N-(1,4-dioxo-1,4-dihydronaphthalen-2-yl)benzamide, with the CAS number 65240-86-0, is a chemical compound characterized by its unique structure that includes a naphthalene derivative with a dioxo functional group and an amide linkage. This compound typically exhibits properties associated with both aromatic and carbonyl functionalities, which can influence its reactivity and solubility. The presence of the dioxo group suggests potential for hydrogen bonding and reactivity in various chemical environments. It may also display biological activity, making it of interest in pharmaceutical research. The compound is likely to be solid at room temperature, with potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Its stability, solubility, and reactivity can vary based on the specific conditions and solvents used. As with many organic compounds, safety data should be consulted to understand any hazards associated with handling and usage.

Formula: C₁₇H₁₁NO₃

InChI: InChI=1/C17H11NO3/c19-15-10-14(16(20)13-9-5-4-8-12(13)15)18-17(21)11-6-2-1-3-7-11/h1-10H,(H,18,21)

SMILES: c1ccc(cc1)C(=NC1=CC(=O)c2ccccc2C1=O)O

2-Benzamido-1,4-naphthoquinone

Controlled Product

CAS: 65240-86-0

Applications 2-Benzamido-1,4-naphthoquinone belongs to a novel class of small molecule inhibitors of histone deacetylase (HDAC6), a family of enzymes that play significant role in numerous biological processes and diseases. 2-Benzamido-1,4-naphthoquinone was also shown to be an activation blocker of nuclear factor-kB (NF-kB).
References Inks, E.S., et al.: ACS. Chem. Biol., 7, 331 (2012); Lien, J.C., et al.: Chem. Pharma. Bull.. 44. 1181 (1996);

Formula: C₁₇H₁₁NO₃

Color and Shape: Neat

Molecular weight: 277.27

Ref: TR-B184990

PPM-18

CAS: 65240-86-0

PPM-18 (NSC 73233), a potent anti-inflammatory, inhibits iNOS and NF-κB binding; also suppresses bladder cancer cell growth.

Formula: C₁₇H₁₁NO₃

Color and Shape: Solid

Molecular weight: 277.27

Ref: TM-T21693