CAS 65242-19-5

3-Quinolinecarbonitrile, 2-amino-5,6,7,8-tetrahydro-

Description:

3-Quinolinecarbonitrile, 2-amino-5,6,7,8-tetrahydro- is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a carbonitrile functional group (-C≡N) and an amino group (-NH2) attached to the quinoline framework, contributing to its reactivity and potential biological activity. The presence of the tetrahydro moiety indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring system that can influence its physical and chemical properties, such as solubility and stability. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The CAS number 65242-19-5 uniquely identifies this compound in chemical databases, facilitating its study and application in research and industry. Overall, the structural features of 3-Quinolinecarbonitrile, 2-amino-5,6,7,8-tetrahydro- suggest it may have diverse applications, particularly in the development of pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₁N₃

InChI: InChI=1S/C10H11N3/c11-6-8-5-7-3-1-2-4-9(7)13-10(8)12/h5H,1-4H2,(H2,12,13)

InChI key: InChIKey=ZBOFTCWMOSKYLC-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C2C(=NC1N)CCCC2

Synonyms:

• 2-Amino-5,6,7,8-tetrahydroquinoline-3-carbonitrile
• 3-Quinolinecarbonitrile, 2-amino-5,6,7,8-tetrahydro-