CAS 6526-08-5
:2-Amino-5-trifluoromethylbenzonitrile
Description:
2-Amino-5-trifluoromethylbenzonitrile, with the CAS number 6526-08-5, is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a benzene ring that also contains a nitrile functional group. This compound typically appears as a solid and is known for its aromatic properties due to the benzene ring. The trifluoromethyl group contributes to its unique electronic characteristics, enhancing its reactivity and making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The amino group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the nitrile group imparts polarity, which can affect the compound's physical properties, such as melting and boiling points. Overall, 2-Amino-5-trifluoromethylbenzonitrile is notable for its potential applications in synthetic chemistry and material science, owing to its distinctive functional groups and structural features.
Formula:C8H5F3N2
InChI:InChI=1/C8H5F3N2/c9-8(10,11)6-1-2-7(13)5(3-6)4-12/h1-3H,13H2
SMILES:c1cc(c(cc1C(F)(F)F)C#N)N
Synonyms:- 4-Amino-3-cyanobenzotrifluoride
- 3-Cyano-4-aminobenzotrifluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-5-(trifluoromethyl)benzonitrile
CAS:Formula:C8H5F3N2Purity:97%Color and Shape:SolidMolecular weight:186.13392-Amino-5-(trifluoromethyl)benzonitrile
CAS:<p>2-Amino-5-(trifluoromethyl)benzonitrile</p>Formula:C8H5F3N2Purity:≥95%Color and Shape: faint lemon crystalline powderMolecular weight:186.13g/mol2-Amino-5-(trifluoromethyl)benzonitrile
CAS:<p>2-Amino-5-(trifluoromethyl)benzonitrile is a versatile chemical building block that can be used in a variety of reactions. It has been used as a reagent and intermediate for research, as well as a speciality chemical. This compound has been found to have applications in the synthesis of complex compounds, such as pharmaceuticals and agrochemicals. 2-Amino-5-(trifluoromethyl)benzonitrile is also a useful scaffold for organic synthesis, due to its high quality and versatility.</p>Formula:C8H5F3N2Purity:Min. 95%Color and Shape:solid.Molecular weight:186.13 g/mol3-Cyano-4-aminobenzotrifluoride
CAS:Formula:C8H5F3N2Purity:95%Color and Shape:SolidMolecular weight:186.137




