CAS 6526-66-5

2-amino-N,N-dimethylbenzamide

Description:

2-Amino-N,N-dimethylbenzamide, with the CAS number 6526-66-5, is an organic compound characterized by the presence of an amine group and a benzamide structure. It features a benzene ring substituted with an amine group (-NH2) and two methyl groups attached to the nitrogen atom, making it a dimethyl derivative. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents due to its ability to form hydrogen bonds. The presence of the amino group contributes to its basicity, while the benzamide moiety can participate in various chemical reactions, including acylation and amidation. 2-Amino-N,N-dimethylbenzamide may be used in pharmaceutical applications, as well as in organic synthesis as an intermediate for producing other chemical compounds. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture. Safety data should be consulted for handling and storage guidelines.

Formula: C₉H₁₂N₂O

InChI: InChI=1/C9H12N2O/c1-11(2)9(12)7-5-3-4-6-8(7)10/h3-6H,10H2,1-2H3

SMILES: CN(C)C(=O)c1ccccc1N

Synonyms:

• benzamide, 2-amino-N,N-dimethyl-
• 2-amino-N,N-dimethyl-benzamide

2-Amino-N,N-dimethylbenzamide

CAS: 6526-66-5

Formula: C₉H₁₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.2044

Ref: IN-DA0036XP

2-Amino-N,N-dimethylbenzamide

CAS: 6526-66-5

2-Amino-N,N-dimethylbenzamide

Purity: 95%

Molecular weight: 164.20g/mol

Ref: 54-OR33559

2-Amino-N,N-dimethyl-benzamide

CAS: 6526-66-5

Formula: C₉H₁₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.208

Ref: 10-F044467

2-Amino-N,N-dimethylbenzamide

CAS: 6526-66-5

2-Amino-N,N-dimethylbenzamide is an organic compound with the chemical formula CH3CONH2. It is a white solid with a pungent odor. 2-Amino-N,N-dimethylbenzamide is used as an industrial chemical in the synthesis of selenium oxide and carbon monoxide. It also acts as a catalyst for various reactions such as the synthesis of acetaldehyde from ethanol and oxygen gas or the conversion of ammonia to nitric acid.

Formula: C₉H₁₂N₂O

Purity: Min. 95%

Molecular weight: 164.2 g/mol

Ref: 3D-GAA52666