CAS 65267-53-0

4,6-Diethyl-2-hydrazinylpyrimidine

Description:

4,6-Diethyl-2-hydrazinylpyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of diethyl groups at positions 4 and 6 contributes to its hydrophobic properties, while the hydrazinyl group at position 2 introduces reactivity typical of hydrazines, such as the potential for forming hydrazones and undergoing oxidation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the pyrimidine ring, making it a subject of study in various chemical and biological contexts. Safety and handling precautions should be observed due to the presence of the hydrazine functional group, which is known for its toxicity and potential carcinogenic properties.

Formula: C₈H₁₄N₄

InChI: InChI=1S/C8H14N4/c1-3-6-5-7(4-2)11-8(10-6)12-9/h5H,3-4,9H2,1-2H3,(H,10,11,12)

InChI key: InChIKey=IULFIJFOEYJVJP-UHFFFAOYSA-N

SMILES: C(C)C1=CC(CC)=NC(=NN)N1

Synonyms:

• 2(1H)-Pyrimidinone, 4,6-diethyl-, hydrazone
• 4,6-Diethyl-2-hydrazinylpyrimidine
• Pyrimidine, 4,6-diethyl-2-hydrazinyl-