CAS 6527-32-8
:4-(benzyloxy)-3,5-dimethoxybenzaldehyde
Description:
4-(Benzyloxy)-3,5-dimethoxybenzaldehyde, with the CAS number 6527-32-8, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features two methoxy groups (-OCH3) and a benzyloxy group (-O-Ph) attached to a benzene ring, contributing to its overall stability and reactivity. The presence of these substituents influences its chemical properties, such as solubility and reactivity in various chemical reactions, including electrophilic aromatic substitution. Typically, compounds like this exhibit moderate to high lipophilicity due to the hydrophobic aromatic rings, making them soluble in organic solvents. Additionally, the methoxy groups can act as electron-donating groups, enhancing the nucleophilicity of the aromatic system. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. Its unique structure allows for potential applications in various fields, including medicinal chemistry and materials science.
Formula:C16H16O4
InChI:InChI=1/C16H16O4/c1-18-14-8-13(10-17)9-15(19-2)16(14)20-11-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3
SMILES:COc1cc(cc(c1OCc1ccccc1)OC)C=O
Synonyms:- 3,5-Dimethoxy-4-(phenylmethoxy)benzaldehyde
- Benzaldehyde, 3,5-dimethoxy-4-(phenylmethoxy)-
- Benzaldehyde, 4-(benzyloxy)-3,5-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Benzyloxy)-3,5-dimethoxybenzaldehyde
CAS:Formula:C16H16O4Purity:98%Color and Shape:SolidMolecular weight:272.29584-(Benzyloxy)-3,5-dimethoxybenzaldehyde
CAS:4-(Benzyloxy)-3,5-dimethoxybenzaldehydePurity:97%Molecular weight:272.30g/mol4-(Benzyloxy)-3,5-dimethoxybenzaldehyde
CAS:Formula:C16H16O4Purity:98%Color and Shape:SolidMolecular weight:272.34-(Benzyloxy)-3,5-dimethoxybenzaldehyde
CAS:4-(Benzyloxy)-3,5-dimethoxybenzaldehyde is a phosphonium salt that can be used in vitro assays for the determination of the activity of glyceric, hydrochloric acid, colchicine, catechol-o-methyltransferase and asymmetric synthesis. This compound has also been shown to be a ligand for the receptor protein of several viruses. 4-(Benzyloxy)-3,5-dimethoxybenzaldehyde has been shown to inhibit the growth of virus in vivo through its interaction with the receptor protein.Formula:C16H16O4Purity:Min. 95%Molecular weight:272.3 g/mol



