CAS 65287-34-5

2-chloropyridine-4-carbonyl chloride

Description:

2-Chloropyridine-4-carbonyl chloride, with the CAS number 65287-34-5, is an organic compound characterized by its pyridine ring structure substituted with a chlorine atom and a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and environmental conditions. It is known for its reactivity, particularly due to the presence of the carbonyl chloride group, which can undergo nucleophilic substitution reactions. This makes it useful in various synthetic applications, including the preparation of pharmaceuticals and agrochemicals. The chlorine atom on the pyridine ring can also participate in further chemical transformations, enhancing its utility in organic synthesis. Additionally, 2-chloropyridine-4-carbonyl chloride is generally handled with care due to its potential toxicity and corrosive nature, necessitating appropriate safety measures during its use and storage. Overall, its unique structural features and reactivity profile make it a valuable compound in chemical research and industrial applications.

Formula: C₆H₃Cl₂NO

InChI: InChI=1/C6H3Cl2NO/c7-5-3-4(6(8)10)1-2-9-5/h1-3H

2-Chloroisonicotinoylchloride

CAS: 65287-34-5

Formula: C₆H₃Cl₂NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 176.0001

Ref: IN-DA003H2K

2-Chloroisonicotinoyl chloride

CAS: 65287-34-5

2-Chloroisonicotinoyl chloride

Formula: C₆H₃Cl₂NO

Purity: 95%

Color and Shape: colourless liquid

Molecular weight: 176.00g/mol

Ref: 54-OR29882

2-Chloroisonicotinoyl Chloride

Controlled Product

CAS: 65287-34-5

Applications 2-chloropyridine-4-carbonyl chloride (cas# 65287-34-5) is a useful research chemical.

Formula: C₆H₃NOCl₂

Color and Shape: Neat

Molecular weight: 176.0

Ref: TR-B405163

2-Chloropyridine-4-carbonyl chloride

CAS: 65287-34-5

Formula: C₆H₃Cl₂NO

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 176

Ref: 10-F017100