
CAS 652969-01-2
:Amlodipine camsylate
Description:
Amlodipine camsylate is a pharmaceutical compound primarily used as an antihypertensive agent. It is a salt form of amlodipine, which is a calcium channel blocker that helps to relax blood vessels and improve blood flow, thereby lowering blood pressure. The substance is characterized by its solubility in various solvents, which can influence its bioavailability and therapeutic efficacy. Amlodipine camsylate is typically administered in oral dosage forms and is known for its long half-life, allowing for once-daily dosing. The compound exhibits a favorable safety profile, with common side effects including headache, edema, and fatigue. Its mechanism of action involves the inhibition of calcium ions from entering vascular smooth muscle and cardiac muscle, leading to vasodilation. As with any medication, it is essential to consider potential drug interactions and contraindications when prescribing or using amlodipine camsylate. Overall, it plays a significant role in the management of hypertension and certain types of angina.
Formula:C20H25ClN2O5·C10H16O4S
InChI:InChI=1S/C20H25ClN2O5.C10H16O4S/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h5-8,17,23H,4,9-11,22H2,1-3H3;7H,3-6H2,1-2H3,(H,12,13,14)/t;7-,10-/m.1/s1
InChI key:InChIKey=UXKMFEPPKJZDAR-STOWLHSFSA-N
SMILES:C(OCC)(=O)C=1C(C(C(OC)=O)=C(C)NC1COCCN)C2=C(Cl)C=CC=C2.C(S(=O)(=O)O)[C@@]12C(C)(C)[C@@](CC1=O)(CC2)[H]
Synonyms:- 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, (1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate (1:1)
- 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, mono[(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate]
- Amlodipine camphorsulfonate
- Amlodipine camsylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amlodipine camsylate
CAS:Amlodipine camsylate is a medication used to lower blood pressure and prevent chest pain.Formula:C30H41ClN2O9SColor and Shape:SolidMolecular weight:641.17
