CymitQuimica logo

CAS 652971-46-5

:

(3R,4S)-4-Phenylpyrrolidine-3-carboxylic acid

Description:
(3R,4S)-4-Phenylpyrrolidine-3-carboxylic acid is a chiral compound characterized by its pyrrolidine ring structure, which includes a phenyl group and a carboxylic acid functional group. The specific stereochemistry indicated by the (3R,4S) notation suggests that the molecule has distinct spatial arrangements at the chiral centers, which can significantly influence its biological activity and interactions. This compound is often studied in the context of medicinal chemistry due to its potential applications in drug development, particularly in the design of pharmaceuticals that target specific receptors or enzymes. Its carboxylic acid group contributes to its solubility in polar solvents and can participate in hydrogen bonding, enhancing its reactivity and interaction with biological systems. The presence of the phenyl group may also impart hydrophobic characteristics, influencing the compound's overall pharmacokinetics. As with many chiral compounds, the specific enantiomer can exhibit different properties and activities, making stereochemical purity an important consideration in its synthesis and application.
Formula:C11H13NO2
InChI:InChI=1/C11H13NO2/c13-11(14)10-7-12-6-9(10)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.