CAS 652979-82-3

5-(4-Fluorophenyl)-2-pyrazinecarboxylic acid

Description:

5-(4-Fluorophenyl)-2-pyrazinecarboxylic acid is a chemical compound characterized by its pyrazine and carboxylic acid functional groups, along with a fluorophenyl substituent. This compound typically exhibits a solid-state at room temperature and is soluble in polar organic solvents, which is common for carboxylic acids. The presence of the fluorine atom on the phenyl ring can influence its electronic properties, potentially enhancing its reactivity and biological activity. The pyrazine ring contributes to its aromatic character and may participate in various chemical interactions, such as hydrogen bonding and π-π stacking. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its specific properties, such as melting point, boiling point, and spectral characteristics, would need to be determined through experimental methods or referenced from reliable chemical databases. Overall, 5-(4-Fluorophenyl)-2-pyrazinecarboxylic acid represents a versatile structure in organic synthesis and pharmaceutical research.

Formula: C₁₁H₇FN₂O₂

InChI: InChI=1S/C11H7FN2O2/c12-8-3-1-7(2-4-8)9-5-14-10(6-13-9)11(15)16/h1-6H,(H,15,16)

InChI key: InChIKey=UDUYQYBNZRZQIZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=CC(=NC1)C2=CC=C(F)C=C2

Synonyms:

• 5-(4-Fluorophenyl)-2-pyrazinecarboxylic acid
• 2-Pyrazinecarboxylic acid, 5-(4-fluorophenyl)-
• Pyrazinecarboxylic acid, 5-(4-fluorophenyl)-