CAS 65309-11-7

(αR,3S)-3-[[(2R)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-1-azetidineacetic acid

Description:

The chemical substance known as "(αR,3S)-3-[[(2R)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-1-azetidineacetic acid," with the CAS number 65309-11-7, is a synthetic compound that belongs to the class of amino acids and derivatives. It features a unique azetidine ring structure, which contributes to its potential biological activity. The presence of multiple functional groups, including amino, hydroxyl, and carbonyl groups, suggests that this compound may exhibit significant interactions with biological macromolecules, such as proteins and enzymes. Its stereochemistry, indicated by the specific configuration at the α and 3 positions, is crucial for its biological function and activity. This compound may be of interest in medicinal chemistry and pharmacology due to its potential therapeutic applications, particularly in the development of drugs targeting specific biological pathways. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its characteristics and potential uses in clinical settings.

Formula: C₁₉H₁₉N₃O₆

InChI: InChI=1S/C19H19N3O6/c20-15(10-1-5-12(23)6-2-10)17(25)21-14-9-22(18(14)26)16(19(27)28)11-3-7-13(24)8-4-11/h1-8,14-16,23-24H,9,20H2,(H,21,25)(H,27,28)/t14-,15+,16+/m0/s1

InChI key: InChIKey=SAVAPYNOQXYBJS-ARFHVFGLSA-N

SMILES: [C@@H](C(O)=O)(N1C(=O)[C@@H](NC([C@H](N)C2=CC=C(O)C=C2)=O)C1)C3=CC=C(O)C=C3

Synonyms:

• 1-Azetidineacetic acid, 3-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-, (αR,3S)-
• Nocardicin G
• 1-Azetidineacetic acid, 3-[[(2R)-amino(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-, (αR,3S)-
• 1-Azetidineacetic acid, 3-[[amino(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-, [3S-[1(S*),3R*(S*)]]-
• (αR,3S)-3-[[(2R)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-1-azetidineacetic acid

Nocardicin G

CAS: 65309-11-7

Nocardicin G is a universal precursor of nocardicins.

Formula: C₁₉H₁₉N₃O₆

Color and Shape: Solid

Molecular weight: 385.37

Ref: TM-T33709

Nocardicin G

CAS: 65309-11-7

Nocardicin G is a monocyclic β-lactam antibiotic, which is sourced from certain strains of the soil-dwelling actinobacterium *Nocardia*. This organism is known for its ability to synthesize various bioactive compounds. The mode of action of Nocardicin G involves inhibiting bacterial cell wall synthesis by targeting penicillin-binding proteins, resulting in the bactericidal effect against susceptible bacterial strains. This compound specifically disrupts the formation of the peptidoglycan layer, which is essential for bacterial integrity and survival.

Formula: C₁₉H₁₉N₃O₆

Purity: Min. 95%

Molecular weight: 385.4 g/mol

Ref: 3D-QCA30911