CAS 65312-86-9
:Primulasaponin
Description:
Primulasaponin, with the CAS number 65312-86-9, is a saponin compound primarily derived from the Primula species, particularly Primula veris. Saponins are glycosides that possess both hydrophilic and hydrophobic properties, allowing them to form stable foams and emulsions in aqueous solutions. Primulasaponin exhibits surfactant-like behavior, which can contribute to its potential applications in pharmaceuticals and cosmetics. It is known for its biological activities, including potential anti-inflammatory, antimicrobial, and cytotoxic effects, making it of interest in medicinal chemistry. The compound's structure typically features a steroid or triterpenoid backbone linked to sugar moieties, which is characteristic of many saponins. Due to its complex nature, Primulasaponin may also interact with cell membranes, influencing permeability and cellular processes. However, further research is necessary to fully elucidate its mechanisms of action and therapeutic potential. As with many natural products, the extraction and purification processes can significantly affect its bioactivity and stability.
Formula:C54H88O23
InChI:InChI=1S/C54H88O23/c1-22-30(58)33(61)36(64)44(70-22)76-41-35(63)32(60)24(20-56)72-46(41)74-39-38(66)40(43(67)68)75-47(42(39)77-45-37(65)34(62)31(59)23(19-55)71-45)73-29-11-12-50(6)25(49(29,4)5)9-13-51(7)26(50)10-14-54-27-17-48(2,3)15-16-53(27,21-69-54)28(57)18-52(51,54)8/h22-42,44-47,55-66H,9-21H2,1-8H3,(H,67,68)/t22-,23+,24+,25-,26+,27+,28+,29-,30-,31+,32-,33+,34-,35-,36+,37+,38-,39-,40-,41+,42+,44-,45-,46-,47+,50-,51+,52-,53+,54-/m0/s1
InChI key:InChIKey=DQUUSJCGJNQFPG-CBMAJASRSA-N
SMILES:C[C@]12[C@@]3([C@]4([C@@](CO3)([C@H](O)C1)CCC(C)(C)C4)[H])CC[C@]5([C@@]2(C)CC[C@@]6([C@]5(C)CC[C@H](O[C@H]7[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@@H](O[C@H]9[C@H](O[C@H]%10[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O%10)[C@@H](O)[C@@H](O)[C@@H](CO)O9)[C@H](O)[C@@H](C(O)=O)O7)C6(C)C)[H])[H]
Synonyms:- (3β,16α)-13,28-Epoxy-16-hydroxyoleanan-3-yl O-6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl-(1→2)-O-β-<smallcap>D</smallcap>-galactopyranosyl-(1→3)-O-[β-<smallcap>D</smallcap>-glucopyranosyl-(1→2)]-β-<smallcap>D</span>-glucopyranosiduronic acid
- Primulasaponin
- Primulasaponin 1
- Primulasaponin I
- Saponin PS 4 from Primula elatior
- Saponin PS 4 from Primulaelatior
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranosiduronic acid, (3β,16α)-13,28-epoxy-16-hydroxyoleanan-3-yl O-6-deoxy-α-<smallcap>L</smallcap>-mannopyranosyl-(1→2)-O-β-<smallcap>D</smallcap>-galactopyranosyl-(1→3)-O-[β-<smallcap>D</span>-glucopyranosyl-(1→2)]-
- β-D-Glucopyranosiduronic acid, (3β,16α)-13,28-epoxy-16-hydroxyoleanan-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-β-D-galactopyranosyl-(1→3)-O-[β-D-glucopyranosyl-(1→2)]-
- (3β,16α)-13,28-Epoxy-16-hydroxyoleanan-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-β-D-galactopyranosyl-(1→3)-O-[β-D-glucopyranosyl-(1→2)]-β-D-glucopyranosiduronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Primulasaponin 1
CAS:<p>Primulasaponin 1 is a useful organic compound for research related to life sciences. The catalog number is T124469 and the CAS number is 65312-86-9.</p>Formula:C54H88O23Color and Shape:SolidMolecular weight:1105.28Primulic acid i
CAS:Natural glycosideFormula:C54H88O23Purity:≥ 75.0 % (HPLC)Color and Shape:PowderMolecular weight:1105.28Primulic acid 1
CAS:<p>Primulic acid 1 is a saponin, which is a bioactive compound derived primarily from the plant species Primula. These plants are known for their rich saponin content, which exerts biological effects through various mechanisms, including forming complexes with sterols and disrupting cell membranes. This mode of action allows Primulic acid 1 to exhibit significant anti-inflammatory and antimicrobial properties by interfering with the lipid membranes of pathogens and inhibiting key inflammatory pathways.</p>Formula:C54H88O23Purity:Min. 95%Molecular weight:1,105.3 g/mol




