CAS 6532-17-8

1-[(2,3-dioxo-2,3-dihydro-1H-indol-1-yl)methyl]-4-(2-hydroxyethyl)piperazinediium

Description:

1-[(2,3-dioxo-2,3-dihydro-1H-indol-1-yl)methyl]-4-(2-hydroxyethyl)piperazinediium, with the CAS number 6532-17-8, is a complex organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 2,3-dioxo-2,3-dihydro-1H-indole moiety contributes to its potential biological activity, as indole derivatives are known for their diverse pharmacological properties. The hydroxyethyl substituent enhances the compound's solubility and may influence its interaction with biological targets. This compound is likely to exhibit cationic properties due to the diium structure, which can affect its behavior in solution and its ability to interact with anionic species. Its unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies on its stability, reactivity, and biological effects would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₅H₂₁N₃O₃

InChI: InChI=1/C15H19N3O3/c19-10-9-16-5-7-17(8-6-16)11-18-13-4-2-1-3-12(13)14(20)15(18)21/h1-4,19H,5-11H2/p+2

1-{[4-(2-Hydroxyethyl)piperazin-1-yl]methyl}-2,3-dihydro-1H-indole-2,3-dione

CAS: 6532-17-8

Versatile small molecule scaffold

Formula: C₁₅H₁₉N₃O₃

Purity: Min. 95%

Molecular weight: 289.33 g/mol

Ref: 3D-GAA53217