CAS 65322-64-7
:2,3-Dihydro-2,2-dimethyl-4-[2-[4-(2-phenyldiazenyl)-1-naphthalenyl]diazenyl]-1H-perimidine
Description:
2,3-Dihydro-2,2-dimethyl-4-[2-[4-(2-phenyldiazenyl)-1-naphthalenyl]diazenyl]-1H-perimidine, with CAS number 65322-64-7, is a complex organic compound characterized by its azo dye structure, which features multiple aromatic systems. This compound typically exhibits vibrant colors due to the presence of the azo (-N=N-) functional group, which is known for its ability to absorb visible light. The perimidine core contributes to its stability and potential applications in dye chemistry. The presence of multiple substituents, including phenyl and naphthyl groups, enhances its electronic properties and solubility in various organic solvents. Such compounds are often investigated for their potential use in textiles, inks, and as biological stains due to their vivid coloration and stability. Additionally, the structural complexity may influence its reactivity and interaction with other chemical species, making it a subject of interest in both synthetic and applied chemistry. Safety and handling precautions should be observed, as azo compounds can sometimes be associated with environmental and health concerns.
Formula:C29H24N6
InChI:InChI=1S/C29H24N6/c1-29(2)30-25-14-8-9-19-15-16-26(28(31-29)27(19)25)35-34-24-18-17-23(21-12-6-7-13-22(21)24)33-32-20-10-4-3-5-11-20/h3-18,30-31H,1-2H3
InChI key:InChIKey=GJCRKKWVOHKHIQ-UHFFFAOYSA-N
SMILES:N(=NC=1C2=C(C(N=NC3=CC=CC=C3)=CC1)C=CC=C2)C4=C5C6=C(C=C4)C=CC=C6NC(C)(C)N5
Synonyms:- 1H-Perimidine, 2,3-dihydro-2,2-dimethyl-4-[2-[4-(2-phenyldiazenyl)-1-naphthalenyl]diazenyl]-
- 1H-Perimidine, 2,3-dihydro-2,2-dimethyl-4-[[4-(phenylazo)-1-naphthalenyl]azo]-
- 2,2-dimethyl-4-naphthalen-1-yl-4-[(1E,3E)-4-phenyltetraaza-1,3-dien-1-yl]-2,3,3a,4-tetrahydro-1H-perimidine
- 2,3-Dihydro-2,2-dimethyl-4-[(4-phenylazo-1-naphthalenyl)-azo]-1H-perimidine
- 2,3-Dihydro-2,2-dimethyl-4-[2-[4-(2-phenyldiazenyl)-1-naphthalenyl]diazenyl]-1H-perimidine
- 2,3-Dihydro-2,2-dimethyl-4-((1-naphthyl-4-(phenylazo))azo)-1H-perimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.