CymitQuimica logo

CAS 65322-85-2

:

Benzenepropanoic acid,4-(2-methylpropyl)-

Description:
Benzenepropanoic acid, 4-(2-methylpropyl)-, also known by its CAS number 65322-85-2, is an aromatic carboxylic acid characterized by a benzene ring substituted with a propanoic acid group and a branched alkyl chain. This compound typically exhibits a hydrophobic nature due to the presence of the benzene ring and the alkyl substituent, which can influence its solubility in organic solvents while being less soluble in water. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and acid-base reactions. Its structure suggests potential applications in organic synthesis, pharmaceuticals, and as an intermediate in the production of other chemical compounds. Additionally, the branched alkyl group may affect its physical properties, such as boiling point and melting point, compared to its straight-chain counterparts. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C13H18O2
InChI:InChI=1S/C13H18O2/c1-10(2)9-12-5-3-11(4-6-12)7-8-13(14)15/h3-6,10H,7-9H2,1-2H3,(H,14,15)
InChI key:DYNVRFFVBZVRND-UHFFFAOYSA-N
SMILES:CC(C)CC1=CC=C(C=C1)CCC(=O)O
Synonyms:
  • 3-(4-Isobutylphenyl)propanoicacid
  • 3-(4'-Isobutylphenyl)propionic acid
  • 3-(p-Isobutylphenyl)propionic acid
Found 11 products.