CAS 65322-85-2
:Benzenepropanoic acid,4-(2-methylpropyl)-
Description:
Benzenepropanoic acid, 4-(2-methylpropyl)-, also known by its CAS number 65322-85-2, is an aromatic carboxylic acid characterized by a benzene ring substituted with a propanoic acid group and a branched alkyl chain. This compound typically exhibits a hydrophobic nature due to the presence of the benzene ring and the alkyl substituent, which can influence its solubility in organic solvents while being less soluble in water. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and acid-base reactions. Its structure suggests potential applications in organic synthesis, pharmaceuticals, and as an intermediate in the production of other chemical compounds. Additionally, the branched alkyl group may affect its physical properties, such as boiling point and melting point, compared to its straight-chain counterparts. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C13H18O2
InChI:InChI=1S/C13H18O2/c1-10(2)9-12-5-3-11(4-6-12)7-8-13(14)15/h3-6,10H,7-9H2,1-2H3,(H,14,15)
InChI key:DYNVRFFVBZVRND-UHFFFAOYSA-N
SMILES:CC(C)CC1=CC=C(C=C1)CCC(=O)O
Synonyms:- 3-(4-Isobutylphenyl)propanoicacid
- 3-(4'-Isobutylphenyl)propionic acid
- 3-(p-Isobutylphenyl)propionic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-(4-Isobutylphenyl)Propanoic Acid
CAS:3-(4-Isobutylphenyl)Propanoic AcidFormula:C13H18O2Purity:97%Molecular weight:206.283-(4-Isobutylphenyl)Propanoic Acid
CAS:Formula:C13H18O2Purity:97%Color and Shape:SolidMolecular weight:206.2808Ibuprofen EP Impurity F
CAS:Formula:C13H18O2Color and Shape:White To Off-White SolidMolecular weight:206.29Ibuprofen Impurity F
CAS:Ibuprofen Impurity F, anti-inflammatory, inhibits COX-1 and COX-2 with IC50 of 13 μM and 370 μM.Formula:C13H18O2Color and Shape:SolidMolecular weight:206.2808Ibuprofen EP Impurity F
CAS:Controlled ProductFormula:C13H18O2Color and Shape:NeatMolecular weight:206.283-(4-Isobutylphenyl)propanoic Acid
CAS:Controlled ProductImpurity Ibuprofen EP Impurity F
Applications 3-(4-Isobutylphenyl)propanoic acid (Ibuprofen EP Impurity F) is an impurity of Ibuprofen (I140000). Ibuprofen impurity F as per EP.
References Haikala, V., et al.: J. Pharm. Sci., 80, 456 (1991), Zhao, J., et al.: Anal. Chem., 72, 302 (2000), Kucera, R., et al.: J. Pharm. Biomed. Anal., 38, 609 (2005),Formula:C13H18O2Color and Shape:NeatMolecular weight:206.28Ibuprofen Impurity F
CAS:3-(4-Isobutylphenyl)propanoic acidFormula:C13H18O2Purity:97%Molecular weight:206.283-(4-Isobutylphenyl)propanoic acid
CAS:Formula:C13H18O2Purity:97%Color and Shape:SolidMolecular weight:206.285










