CAS 65326-33-2

2-amino-3-acetylpyridine

Description:

2-Amino-3-acetylpyridine, with the CAS number 65326-33-2, is an organic compound that features a pyridine ring substituted with an amino group and an acetyl group. This compound typically appears as a solid or crystalline substance and is characterized by its pale yellow to light brown color. It has a molecular formula of C7H8N2O, indicating the presence of carbon, hydrogen, nitrogen, and oxygen atoms. The amino group (-NH2) contributes to its basicity, while the acetyl group (-COCH3) enhances its reactivity, making it a useful intermediate in organic synthesis. 2-Amino-3-acetylpyridine is known for its potential applications in pharmaceuticals, agrochemicals, and as a building block in the synthesis of various heterocyclic compounds. Its solubility in polar solvents, such as water and alcohols, allows for versatile use in chemical reactions. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential therapeutic applications.

Formula: C₇H₈N₂O

InChI: InChI=1/C7H8N2O/c1-5(10)6-3-2-4-9-7(6)8/h2-4H,1H3,(H2,8,9)

SMILES: CC(=O)c1cccnc1N

Synonyms:

• 1-(2-Aminopyridin-3-yl)ethanon
• 1-(2-Aminopyridin-3-yl)ethanone
• Ethanone, 1-(2-Amino-3-Pyridinyl)-

1-(2-Aminopyridin-3-yl)ethanone

CAS: 65326-33-2

Formula: C₇H₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 136.1512

Ref: IN-DA003CTC

3-Acetyl-2-aminopyridine

CAS: 65326-33-2

3-Acetyl-2-aminopyridine

Purity: 97%

Color and Shape: Solid

Molecular weight: 136.15122g/mol

Ref: 54-OR15249

1-(2-Aminopyridin-3-yl)ethanone

CAS: 65326-33-2

Formula: C₇H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 136.154

Ref: 10-F236891