CAS 65340-70-7

6-Bromo-4-chloroquinoline

Description:

6-Bromo-4-chloroquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. This compound features a bromine atom at the 6-position and a chlorine atom at the 4-position of the quinoline structure, contributing to its unique reactivity and properties. It is typically a solid at room temperature and may exhibit a pale yellow to brown color. The presence of halogen substituents can influence its solubility in various organic solvents, often making it more soluble in polar solvents. 6-Bromo-4-chloroquinoline is of interest in medicinal chemistry and materials science due to its potential biological activity, including antimicrobial and antitumor properties. Additionally, it can serve as an intermediate in the synthesis of other complex organic molecules. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures should be followed.

Formula: C₉H₅BrClN

InChI: InChI=1/C9H5BrClN/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-5H

SMILES: c1cc2c(cc1Br)c(ccn2)Cl

6-Bromo-4-chloroquinoline

CAS: 65340-70-7

Formula: C₉H₅BrClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 242.4997

Ref: IN-DA0034CB

6-Bromo-4-chloroquinoline

CAS: 65340-70-7

Formula: C₉H₅BrClN

Purity: >98.0%(GC)

Color and Shape: White - Yellow Solid Form

Molecular weight: 242.50

Ref: 3B-B5166

6-Bromo-4-chloroquinoline

CAS: 65340-70-7

6-Bromo-4-chloroquinoline

Purity: 98%

Color and Shape: Powder

Molecular weight: 242.50g/mol

Ref: 54-OR43545

6-Bromo-4-chloroquinoline

CAS: 65340-70-7

6-Bromo-4-chloroquinoline is a chemical compound with the molecular formula C8H6BrClN. It belongs to the class of heterocyclic compounds and has been used in the synthesis of other compounds, such as pharmaceuticals. 6-Bromo-4-chloroquinoline has been shown to be an effective anticancer drug, with measurable levels in the blood after oral administration. This drug interacts with hydrogen bonding interactions with thp-1 cells, which are erythrocytes derived from human peripheral blood lymphocytes. 6-Bromo-4-chloroquinoline also interacts with sodium sulfide, which is found in human liver and kidney cells. The pharmacokinetic properties of 6-bromo-4-chloroquine have been studied in rats and mice.

Formula: C₉H₅BrClN

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 242.5 g/mol

Ref: 3D-FB42323

6-Bromo-4-chloroquinoline

CAS: 65340-70-7

Formula: C₉H₅BrClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 242.5

Ref: 10-F067512