CAS 65340-71-8

8-Bromo-4-chloroquinoline

Description:

8-Bromo-4-chloroquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 8 and 4 positions, respectively, enhances its reactivity and potential applications in various fields, including medicinal chemistry and material science. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. Its molecular structure contributes to its biological activity, making it of interest in the development of pharmaceuticals, particularly as potential antimicrobial or anticancer agents. The compound's reactivity can be attributed to the electron-withdrawing effects of the halogen substituents, which can influence its interaction with biological targets. Additionally, 8-Bromo-4-chloroquinoline may undergo various chemical transformations, such as nucleophilic substitutions or coupling reactions, making it a versatile intermediate in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as halogenated compounds can pose health risks.

Formula: C₉H₅BrClN

InChI: InChI=1/C9H5BrClN/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-5H

SMILES: c1cc2c(ccnc2c(c1)Br)Cl

Synonyms:

• Quinoline, 8-Bromo-4-Chloro-
• 4-Chloro-8-bromoquinoline

8-Bromo-4-chloroquinoline

CAS: 65340-71-8

Formula: C₉H₅BrClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 242.4997

Ref: IN-DA003NHP

8-Bromo-4-chloroquinoline

CAS: 65340-71-8

8-Bromo-4-chloroquinoline

Purity: 97%

Color and Shape: Solid

Molecular weight: 242.50g/mol

Ref: 54-OR307505

8-Bromo-4-chloroquinoline

CAS: 65340-71-8

Formula: C₉H₅BrClN

Purity: 95%

Molecular weight: 242.5

Ref: 10-F223663

8-Bromo-4-chloroquinoline

CAS: 65340-71-8

8-Bromo-4-chloroquinoline is a chemotherapeutic that inhibits the growth of cells in the human fibroblast cell line. It also has cytotoxic properties and can be used to treat breast cancer, colon cancer, and leukemia. Cytotoxicity is seen at concentrations of 8-bromo-4-chloroquinoline that are below the concentration required for DNA synthesis inhibition. The mechanism of action of 8-bromo-4-chloroquinoline is not well understood, but it may involve interaction with cytochrome P450 1A1 (CYP1A1) or other cellular proteins.

Formula: C₉H₅BrClN

Purity: Min. 95%

Molecular weight: 242.5 g/mol

Ref: 3D-QCA34071