CymitQuimica logo

CAS 65344-26-5

:

Dibenzofuran, 4-iodo-

Description:
Dibenzofuran, 4-iodo- is an organic compound characterized by the presence of a dibenzofuran core structure with an iodine atom substituted at the 4-position. Its molecular formula typically includes carbon, hydrogen, oxygen, and iodine, reflecting its heterocyclic nature. This compound is part of a larger class of dibenzofurans, which are known for their aromatic properties and potential applications in organic synthesis and materials science. The presence of the iodine atom can influence its reactivity, making it a useful intermediate in various chemical reactions, including electrophilic substitutions and coupling reactions. Additionally, dibenzofuran derivatives have been studied for their biological activities, including potential antimicrobial and anticancer properties. The compound is generally handled with care due to the presence of iodine, which can pose health risks if not managed properly. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility can vary based on purity and environmental conditions.
Formula:C12H7IO
InChI:InChI=1S/C12H7IO/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7H
InChI key:ACEYZYYNAMWIIE-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)I
Found 5 products.