CAS 65350-59-6
:1-Butyl-4-methylpyridinium Bromide
Description:
1-Butyl-4-methylpyridinium bromide is an ionic liquid that belongs to the family of pyridinium-based salts. It is characterized by its quaternary ammonium structure, where a butyl group and a methyl group are attached to the nitrogen atom of the pyridine ring. This compound typically exhibits a low melting point, making it liquid at room temperature, which is a common feature of ionic liquids. It is known for its thermal stability and relatively low volatility compared to conventional organic solvents. The bromide anion contributes to its solubility in various polar solvents, while the butyl and methyl groups enhance its hydrophobic characteristics. 1-Butyl-4-methylpyridinium bromide is often utilized in applications such as electrochemistry, catalysis, and as a solvent for organic reactions due to its unique properties, including ionic conductivity and the ability to dissolve a wide range of organic and inorganic compounds. Additionally, its environmental impact is generally considered lower than that of traditional solvents, making it a subject of interest in green chemistry.
Formula:C10H16BrN
InChI:InChI=1/C10H16N.BrH/c1-3-4-7-11-8-5-10(2)6-9-11;/h5-6,8-9H,3-4,7H2,1-2H3;1H/q+1;/p-1
Synonyms:- Pyridinium, 1-Butyl-4-Methyl-, Bromide (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Butyl-4-methylpyridin-1-ium bromide
CAS:Formula:C10H16BrNPurity:97%Color and Shape:SolidMolecular weight:230.14471-Butyl-4-methylpyridin-1-ium bromide
CAS:1-Butyl-4-methylpyridin-1-ium bromidePurity:98%Molecular weight:230.15g/mol1-Butyl-4-methylpyridinium Bromide
CAS:Formula:C10H16BrNPurity:>98.0%(T)(HPLC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:230.15



