CAS 65355-14-8
:Octahydrobinaphtol
Description:
Octahydrobinaphthol, with the CAS number 65355-14-8, is a bicyclic organic compound characterized by its structure, which consists of two fused cyclohexane rings with hydroxyl groups. This compound is a saturated derivative of binaphthol, meaning it has undergone hydrogenation to remove double bonds, resulting in a fully saturated framework. Octahydrobinaphthol exhibits properties typical of alcohols, including the ability to form hydrogen bonds, which can influence its solubility and reactivity. It is generally a colorless to pale yellow liquid or solid, depending on its specific form and purity. The compound is of interest in various chemical applications, including as a chiral building block in organic synthesis and in the development of pharmaceuticals. Its stereochemistry can lead to different isomers, which may exhibit distinct physical and chemical properties. Additionally, octahydrobinaphthol can participate in various chemical reactions, making it a versatile compound in synthetic organic chemistry.
Formula:C20H22O2
InChI:InChI=1/C20H22O2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h9-12,21-22H,1-8H2
SMILES:C1CCc2c(C1)ccc(c2c1c2CCCCc2ccc1O)O
Synonyms:- (R)-(+)-5,5,6,67,7,8,8-Octahydro-1,1-bi-2-naphtol
- (R)-(+)-5,5,6,6,7,7,8,8-Octahydro(1,1binaphthalene)-2,2-diol
- (R)-(+)-5,5,6,6,7,7,8,8-Octahydro-1,1-bi-2-naphthol
- (R)-(+)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-bi-2-naphthol
- 5,5',6,6',7,7',8,8'-Octahydro-1,1'-Binaphthalene-2,2'-Diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(R)-(+)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-bi-2-naphthol
CAS:Formula:C20H22O2Purity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:294.39(R)-(+)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-bi-2-naphthol, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C20H22O2Purity:98%Color and Shape:Powder or crystalline powder, White to pale creamMolecular weight:294.39(R)-(+)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-bi-2-naphthol, 99%
CAS:<p>(R)-(+)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-bi-2-naphthol, 99%</p>Formula:C20H22O2Purity:99%Color and Shape:off-white pwdr.Molecular weight:294.40(R)-5,5',6,6',7,7',8,8'-Octahydro[1,1'-binaphthalene]-2,2'-diol
CAS:Formula:C20H22O2Purity:95%Color and Shape:SolidMolecular weight:294.3875(R)-(+)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-2-naphthol
CAS:(R)-(+)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-2-naphtholPurity:99%,99%eeMolecular weight:294.39g/mol(R)-5,5',6,6',7,7',8,8'-Octahydro[1,1'-binaphthalene]-2,2'-diol
CAS:Color and Shape:SolidMolecular weight:294.161979944(R)-(+)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-bi-2-naphthol
CAS:Formula:C20H22O2Color and Shape:Off-White to Pale Beige SolidMolecular weight:294.39






