CAS 653584-65-7

3-[(E)-(hydroxyimino)methyl]pyridin-2-amine hydrochloride

Description:

3-[(E)-(hydroxyimino)methyl]pyridin-2-amine hydrochloride is a chemical compound characterized by its pyridine ring structure, which is substituted with an amino group and a hydroxyimino group. This compound typically appears as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in biological and chemical research. The presence of the hydroxyimino functional group suggests potential reactivity, particularly in forming coordination complexes or participating in condensation reactions. The compound may exhibit biological activity, potentially acting as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structural features may also contribute to specific interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, the stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Proper handling and storage conditions are essential to maintain its integrity and efficacy in research or application settings.

Formula: C₆H₈ClN₃O

InChI: InChI=1/C6H7N3O.ClH/c7-6-5(4-9-10)2-1-3-8-6;/h1-4,10H,(H2,7,8);1H/b9-4+;

Synonyms:

• 2-Amino-pyridine-3-carbaldehyde oxime HCl

2-Aminonicotinaldehyde oxime hydrochloride

CAS: 653584-65-7

Formula: C₆H₈ClN₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.6002

Ref: IN-DA003GJY

2-Amino-Pyridine-3-Carbaldehyde Oxime Hydrochloride

CAS: 653584-65-7

2-Amino-Pyridine-3-Carbaldehyde Oxime Hydrochloride

Purity: 98%

Molecular weight: 173.60g/mol

Ref: 54-OR1010310

2-Amino-pyridine-3-carbaldehyde oxime hydrochloride

CAS: 653584-65-7

Purity: 98%

Molecular weight: 173.6

Ref: 10-F986614