CAS 653604-38-7
:3-(cyclopentyloxy)aniline
Description:
3-(Cyclopentyloxy)aniline is an organic compound characterized by the presence of an aniline group substituted with a cyclopentyloxy moiety at the meta position. This compound features a benzene ring with an amino group (-NH2) and an ether functional group (-O-) linked to a cyclopentyl group. The presence of the cyclopentyloxy group can influence the compound's solubility, polarity, and reactivity, making it potentially useful in various chemical applications, including pharmaceuticals and materials science. The molecular structure suggests that it may exhibit interesting electronic properties due to the conjugation between the aromatic system and the amino group. Additionally, the cyclopentyl group can provide steric hindrance, which may affect the compound's interaction with biological targets or its behavior in chemical reactions. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of 3-(cyclopentyloxy)aniline should be assessed before use in any application.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c12-9-4-3-7-11(8-9)13-10-5-1-2-6-10/h3-4,7-8,10H,1-2,5-6,12H2
SMILES:C1CCC(C1)Oc1cccc(c1)N
Synonyms:- Benzenamine, 3-(cyclopentyloxy)-
- 3-(Cyclopentyloxy)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
