CAS 65367-85-3
:1-(2-deoxypentofuranosyl)-5-(prop-2-yn-1-yloxy)pyrimidine-2,4(1H,3H)-dione
Description:
1-(2-Deoxypentofuranosyl)-5-(prop-2-yn-1-yloxy)pyrimidine-2,4(1H,3H)-dione, with the CAS number 65367-85-3, is a synthetic compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with a deoxypentofuranosyl group and a prop-2-yn-1-yloxy moiety, which contributes to its unique chemical properties. The presence of the furanosyl sugar component suggests potential biological activity, possibly related to nucleoside analogs, which are often studied for their antiviral or anticancer properties. The alkyne functional group (prop-2-yn-1-yloxy) may facilitate further chemical modifications or reactions, making it a versatile compound in organic synthesis. Additionally, the diketone structure (2,4-dione) indicates potential reactivity, particularly in condensation reactions or as a ligand in coordination chemistry. Overall, this compound's structural features suggest it may have applications in medicinal chemistry and biochemistry, although specific biological activities would require further investigation.
Formula:C12H14N2O6
InChI:InChI=1/C12H14N2O6/c1-2-3-19-8-5-14(12(18)13-11(8)17)10-4-7(16)9(6-15)20-10/h1,5,7,9-10,15-16H,3-4,6H2,(H,13,17,18)
SMILES:C#CCOc1cn(C2CC(C(CO)O2)O)c(=O)nc1O
Synonyms:- 2,4(1H,3H)-pyrimidinedione, 1-(2-deoxypentofuranosyl)-5-(2-propyn-1-yloxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2'-Deoxy-5-propargyloxyuridine
CAS:<p>2'-Deoxy-5-propargyloxyuridine is a synthetic compound that inhibits the herpes simplex virus by inhibiting thymidylate synthase, an enzyme in the synthesis of DNA. It is used to study the growth rate of herpes virus and has been shown to inhibit murine leukemia L1210 and human l1210 cells at concentrations of 10-20 μg/mL. 2'-Deoxy-5-propargyloxyuridine has also been shown to have inhibitory activities against other viruses, such as polio virus and influenza virus. 2'-Deoxy-5-propargyloxyuridine inhibits biosynthesis by binding to enzymes involved in the synthesis of nucleic acids. The inhibitory dose for this compound is not yet known, but it has been shown to have an inhibitory effect on cell culture when preincubated with cells before infection with herpes simplex virus.</p>Formula:C12H14N2O6Purity:Min. 95%Color and Shape:PowderMolecular weight:282.26 g/mol

