CAS 65370-37-8

(2Z)-2-[amino(nitroso)methylidene]pyridin-1(2H)-ol

Description:

The chemical substance known as (2Z)-2-[amino(nitroso)methylidene]pyridin-1(2H)-ol, with the CAS number 65370-37-8, is a pyridine derivative characterized by the presence of an amino group, a nitroso group, and a hydroxyl group. This compound features a double bond configuration (Z) at the 2-position of the pyridine ring, indicating that the substituents are on the same side of the double bond. The presence of the nitroso group contributes to its potential reactivity and biological activity, as nitroso compounds can participate in various chemical reactions, including nitrosation and redox processes. The hydroxyl group enhances the compound's solubility in polar solvents and may influence its interaction with biological systems. Overall, this compound's unique functional groups suggest potential applications in medicinal chemistry and materials science, although specific biological activities and applications would require further investigation. Its structural complexity and functional diversity make it a subject of interest in various fields of research.

Formula: C₆H₇N₃O₂

InChI: InChI=1/C6H7N3O2/c7-6(8-10)5-3-1-2-4-9(5)11/h1-4,11H,7H2/b6-5-

SMILES: c1ccn(/c(=C(/N)\N=O)/c1)O

PYRIDYLAMIDOXIME-1-OXIDE

CAS: 65370-37-8

Formula: C₆H₇N₃O₂

Purity: 97.0%

Molecular weight: 153.141

Ref: 10-F300880