CAS 65370-91-4
:6-amino-3-pentofuranosyl-1,3,5-triazine-2,4(1H,3H)-dione
Description:
6-Amino-3-pentofuranosyl-1,3,5-triazine-2,4(1H,3H)-dione, with the CAS number 65370-91-4, is a chemical compound that belongs to the class of triazine derivatives. This substance features a triazine ring, which is a six-membered heterocyclic structure containing three nitrogen atoms and three carbon atoms. The presence of an amino group at the 6-position and a pentofuranosyl moiety indicates that it is a nucleoside analog, potentially influencing its biological activity. The compound is characterized by its ability to form hydrogen bonds due to the amino and carbonyl groups, which may contribute to its interactions with biological macromolecules, such as nucleic acids. Its structure suggests potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, making it important to consider these factors in practical applications. Overall, this compound represents a significant area of interest in pharmaceutical research and development.
Formula:C8H12N4O6
InChI:InChI=1/C8H12N4O6/c9-6-10-7(16)12(8(17)11-6)5-4(15)3(14)2(1-13)18-5/h2-5,13-15H,1H2,(H3,9,10,11,16,17)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
