
CAS 65376-20-7
:(5R,6R)-3-[[(1E)-2-(Acetylamino)ethenyl]thio]-6-[(1S)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
Description:
The chemical substance with the name "(5R,6R)-3-[[(1E)-2-(Acetylamino)ethenyl]thio]-6-[(1S)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid" and CAS number "65376-20-7" is a complex organic compound characterized by its bicyclic structure, which includes a nitrogen atom in a ring system. This compound features multiple functional groups, including a carboxylic acid, an acetylamino group, and a hydroxyl group, contributing to its potential biological activity. The stereochemistry indicated by the (R) and (S) designations suggests specific spatial arrangements of atoms, which can significantly influence the compound's reactivity and interactions with biological targets. Its thioether linkage and the presence of a keto group further enhance its chemical diversity. Such compounds are often studied for their pharmacological properties, including antimicrobial or antitumor activities, making them of interest in medicinal chemistry. The detailed structural features and stereochemistry play a crucial role in determining the compound's behavior in biological systems and its potential therapeutic applications.
Formula:C13H16N2O5S
InChI:InChI=1S/C13H16N2O5S/c1-6(16)10-8-5-9(21-4-3-14-7(2)17)11(13(19)20)15(8)12(10)18/h3-4,6,8,10,16H,5H2,1-2H3,(H,14,17)(H,19,20)/b4-3+/t6-,8+,10-/m0/s1
InChI key:InChIKey=PRPNUZWHFGSGRV-NJFHWYBASA-N
SMILES:C(O)(=O)C=1N2[C@@]([C@]([C@H](C)O)(C2=O)[H])(CC1S/C=C/NC(C)=O)[H]
Synonyms:- Antibiotic 17927A2
- Epithienamycin B
- (5R,6R)-3-[[(1E)-2-(Acetylamino)ethenyl]thio]-6-[(1S)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
- Antibiotic 890A2
- Antibiotic MM-22382
- Antibiotic MM 22382
- 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[[(1E)-2-(acetylamino)ethenyl]thio]-6-[(1S)-1-hydroxyethyl]-7-oxo-, (5R,6R)-
- MSD-890A2
- 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[[2-(acetylamino)ethenyl]thio]-6-(1-hydroxyethyl)-7-oxo-, [5R-[3(E),5α,6β(S*)]]-
- MM-22382
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Epithienamycin B
CAS:<p>Epithienamycin B is a natural product isolated from Streptomyces flavoviridis.</p>Formula:C13H16N2O5SColor and Shape:SolidMolecular weight:312.34
