CAS 65385-00-4

2-(Chloromethyl)-4-phenylthiazole

Description:

2-(Chloromethyl)-4-phenylthiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a chloromethyl group (-CH2Cl) attached to the thiazole ring, enhancing its reactivity and potential for further chemical modifications. The presence of a phenyl group (a benzene ring) at the 4-position of the thiazole contributes to its aromatic properties and may influence its solubility and interaction with other molecules. Typically, compounds like this exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. The molecular structure allows for various applications, including as intermediates in organic synthesis or as potential active ingredients in medicinal chemistry. Additionally, the compound's reactivity can be attributed to the electrophilic nature of the chloromethyl group, which can participate in nucleophilic substitution reactions. Safety and handling precautions are essential due to the presence of chlorine, which can pose health risks if not managed properly.

Formula: C₁₀H₈ClNS

InChI: InChI=1S/C10H8ClNS/c11-6-10-12-9(7-13-10)8-4-2-1-3-5-8/h1-5,7H,6H2

InChI key: InChIKey=AJRPYRKMJVWZDT-UHFFFAOYSA-N

SMILES: C(Cl)C1=NC(=CS1)C2=CC=CC=C2

Synonyms:

• 2-(Chloromethyl)-4-phenyl-1,3-thiazole
• Thiazole, 2-(chloromethyl)-4-phenyl-
• 2-(Chloromethyl)-4-phenylthiazole