CAS 654-62-6: 4-Amino-6-(trifluoromethyl)-1,3-benzenedisulfonamide
Description:4-Amino-6-(trifluoromethyl)-1,3-benzenedisulfonamide, with the CAS number 654-62-6, is a chemical compound characterized by its sulfonamide functional groups and a trifluoromethyl substituent. This compound features a benzene ring with two sulfonamide groups (-SO2NH2) and an amino group (-NH2) attached, which contribute to its solubility in polar solvents. The presence of the trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly as antibacterial agents or in other therapeutic contexts. The sulfonamide moiety is known for its ability to inhibit bacterial growth by interfering with folic acid synthesis. Additionally, the compound may exhibit unique physical properties, such as melting and boiling points, which are influenced by its molecular structure and the presence of electronegative fluorine atoms. Overall, 4-Amino-6-(trifluoromethyl)-1,3-benzenedisulfonamide is of interest in both synthetic chemistry and medicinal chemistry due to its functional groups and potential applications.
Formula:C7H8F3N3O4S2
InChI:InChI=1S/C7H8F3N3O4S2/c8-7(9,10)3-1-4(11)6(19(13,16)17)2-5(3)18(12,14)15/h1-2H,11H2,(H2,12,14,15)(H2,13,16,17)
InChI key:InChIKey=KRVABEGPNKGLOT-UHFFFAOYSA-N
SMILES:O=S(=O)(N)C=1C=C(C(=CC1N)C(F)(F)F)S(=O)(=O)N
- Synonyms:
- 1,3-Benzenedisulfonamide, 4-amino-6-(trifluoromethyl)-
- 2,4-Disulfamoyl-5-trifluoromethylaniline
- 4-Amino-6-(Trifluoromethyl)Benzene-1,3-Disulfonamide
- 4-Amino-6-trifluoromethyl-1,3-benzenedisulfonamide
- 5-Trifluoromethyl-2,4-disulfamoylaniline
- NSC 44625
- Toluene-2,4-disulfonamide, 5-amino-α,α,α-trifluoro-
