CAS 654-62-6
:4-Amino-6-(trifluoromethyl)-1,3-benzenedisulfonamide
Description:
4-Amino-6-(trifluoromethyl)-1,3-benzenedisulfonamide, with the CAS number 654-62-6, is a chemical compound characterized by its sulfonamide functional groups and a trifluoromethyl substituent. This compound features a benzene ring with two sulfonamide groups (-SO2NH2) and an amino group (-NH2) attached, which contribute to its solubility in polar solvents. The presence of the trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly as antibacterial agents or in other therapeutic contexts. The sulfonamide moiety is known for its ability to inhibit bacterial growth by interfering with folic acid synthesis. Additionally, the compound may exhibit unique physical properties, such as melting and boiling points, which are influenced by its molecular structure and the presence of electronegative fluorine atoms. Overall, 4-Amino-6-(trifluoromethyl)-1,3-benzenedisulfonamide is of interest in both synthetic chemistry and medicinal chemistry due to its functional groups and potential applications.
Formula:C7H8F3N3O4S2
InChI:InChI=1S/C7H8F3N3O4S2/c8-7(9,10)3-1-4(11)6(19(13,16)17)2-5(3)18(12,14)15/h1-2H,11H2,(H2,12,14,15)(H2,13,16,17)
InChI key:InChIKey=KRVABEGPNKGLOT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(S(N)(=O)=O)C=C(S(N)(=O)=O)C(N)=C1
Synonyms:- 1,3-Benzenedisulfonamide, 4-amino-6-(trifluoromethyl)-
- 2,4-Disulfamoyl-5-trifluoromethylaniline
- 4-Amino-6-(Trifluoromethyl)Benzene-1,3-Disulfonamide
- 4-Amino-6-trifluoromethyl-1,3-benzenedisulfonamide
- 5-Trifluoromethyl-2,4-disulfamoylaniline
- NSC 44625
- Toluene-2,4-disulfonamide, 5-amino-α,α,α-trifluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
2,4-Disulfamyl-5-Trifluoromethylaniline
CAS:Sulfonamides, nesoiFormula:C7H8F3N3O4S2Color and Shape:PowderMolecular weight:318.990832-Amino-4-trifluoromethyl-1,5-benzenedisulfonamide
CAS:Formula:C7H8F3N3O4S2Purity:98%Color and Shape:SolidMolecular weight:319.28134-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide
CAS:4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamidePurity:≥98%Molecular weight:319.28g/mol2-Amino-4-trifluoromethyl-1,5-benzenedisulphonamide
CAS:2-Amino-4-trifluoromethyl-1,5-benzenedisulphonamidePurity:95%Molecular weight:319.28g/mol4-Amino-6-(trifluoromethyl)benzene-1,3-disulphonamide
CAS:Controlled ProductFormula:C7H8F3N3O4S2Color and Shape:NeatMolecular weight:319.284-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide
CAS:4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide (4-Amino-6-(trifluoromethyl)benzene-1,3-d) is a carbonic anhydrase inhibitor, used as a potential anti-Formula:C7H8F3N3O4S2Purity:98.58%Color and Shape:SolidMolecular weight:319.282,4-Disulfamyl-5-trifluoromethylaniline
CAS:Formula:C7H8F3N3O4S2Color and Shape:White To Off-WhiteMolecular weight:319.284-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide
CAS:Formula:C7H8F3N3O4S2Purity:98%Molecular weight:319.274-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide
CAS:<p>4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide (4AFBDS) is a chemical compound that can be used for the treatment of wastewater. It has shown to be effective against anhydrase, which is an enzyme that catalyzes the conversion of water to hydrogen peroxide and hydroxide ion. 4AFBDS also attenuates oxidative stress in cardiac cells and inhibits the production of active oxygen species by inhibiting the activity of carbonic anhydrase. The chromatographic method used to detect 4AFBDS was found to be more sensitive than a standard colorimetric assay, making it a better tool for detecting this compound in wastewater samples. br> br> br> br> br> This compound has been shown to have inhibitory effects on e3 ubiquitin ligase, which plays a role in protein degradation via aut</p>Formula:C7H8F3N3O4S2Purity:Min. 95%Molecular weight:319.28 g/mol










