CAS 65400-98-8

Fenoxacrim

Description:

Fenoxacrim is a chemical compound primarily recognized for its application as a fungicide in agricultural practices. It belongs to the class of compounds known as phenylpyrroles, which are characterized by their ability to inhibit fungal growth by disrupting cellular processes. Fenoxacrim exhibits a broad spectrum of activity against various fungal pathogens, making it valuable in crop protection. The compound is typically applied to control diseases in crops such as cereals and vegetables. Its mode of action involves interference with the biosynthesis of essential cellular components in fungi, leading to growth inhibition. Fenoxacrim is generally considered to have low toxicity to mammals, which contributes to its favorable profile for agricultural use. However, like many agrochemicals, it is subject to regulatory scrutiny to ensure environmental safety and efficacy. Proper handling and application practices are essential to minimize potential risks to non-target organisms and the ecosystem.

Formula: C₁₃H₁₁Cl₂N₃O₄

InChI: InChI=1S/C13H11Cl2N3O4/c1-17-11(20)9(12(21)18(2)13(17)22)10(19)16-6-3-4-7(14)8(15)5-6/h3-5,9H,1-2H3,(H,16,19)

InChI key: InChIKey=ARMMDWRARRNONS-UHFFFAOYSA-N

SMILES: C(NC1=CC(Cl)=C(Cl)C=C1)(=O)C2C(=O)N(C)C(=O)N(C)C2=O

Synonyms:

• Fenoxacrim
• HHP
• 5-Pyrimidinecarboxamide, N-(3,4-dichlorophenyl)hexahydro-1,3-dimethyl-2,4,6-trioxo-
• N-(3,4-Dichlorophenyl)hexahydro-1,3-dimethyl-2,4,6-trioxo-5-pyrimidinecarboxamide