CymitQuimica logo

CAS 654067-65-9

:

Boronic acid, B-[4-[bis(4-methylphenyl)amino]phenyl]-

Description:
Boronic acid, B-[4-[bis(4-methylphenyl)amino]phenyl]- (CAS 654067-65-9) is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a bis(4-methylphenyl)amino group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and materials science. The presence of the bis(4-methylphenyl)amino moiety enhances its electronic properties, potentially making it suitable for use in organic electronics, such as in the development of organic semiconductors or light-emitting devices. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings, making it a versatile building block in chemical research and development.
Formula:C20H20BNO2
InChI:InChI=1S/C20H20BNO2/c1-15-3-9-18(10-4-15)22(19-11-5-16(2)6-12-19)20-13-7-17(8-14-20)21(23)24/h3-14,23-24H,1-2H3
InChI key:XDARIDUNZZQZBQ-UHFFFAOYSA-N
SMILES:B(C1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C)(O)O
Synonyms:
  • Boronic acid, [4-[bis(4-methylphenyl)amino]phenyl]-(9CI)
  • [4-[Bis(4-methylphenyl)amino]phenyl] boronic acid
  • B-[4-[Bis(4-methylphenyl)amino]phenyl]boronic acid
  • Bb[4-[bis(4-methylphenyl)amino]phenyl]-boronicacid
Found 5 products.