CAS 65408-91-5
:Altholactone
Description:
Altholactone, identified by the CAS number 65408-91-5, is a cyclic lactone that is derived from the reaction of an alcohol and a carboxylic acid. This compound typically exhibits characteristics common to lactones, such as being a colorless to pale yellow liquid with a distinctive odor. Altholactone is known for its potential applications in various fields, including pharmaceuticals and as a chemical intermediate in organic synthesis. Its structure features a cyclic ester, which contributes to its reactivity and stability under certain conditions. The compound may also display moderate solubility in organic solvents, making it useful in formulations. Additionally, like many lactones, Altholactone may undergo hydrolysis in the presence of water, leading to the formation of corresponding acids and alcohols. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, Altholactone represents an interesting compound with potential utility in chemical synthesis and industrial applications.
Formula:C13H12O4
InChI:InChI=1/C13H12O4/c14-10-7-6-9-13(17-10)11(15)12(16-9)8-4-2-1-3-5-8/h1-7,9,11-13,15H/t9-,11+,12+,13+/m0/s1
InChI key:InChIKey=ZKIRVBNLJKGIEM-WKSBVSIWSA-N
SMILES:O[C@@H]1[C@H](O[C@@]2([C@]1(OC(=O)C=C2)[H])[H])C3=CC=CC=C3
Synonyms:- Altholactone
- Goniothalenol
- D-xylo-Hept-2-enonic acid, 4,7-anhydro-2,3-dideoxy-7-C-phenyl-, δ-lactone, (7R)-
- 2H-Furo[3,2-b]pyran, D-xylo-hept-2-enonic acid deriv.
- (+)-Altholactone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Altholactone
CAS:Altholactone, a potential antimicrobial for ciprofloxacin-resistant S. aureus/E. faecalis, also induces cancer cell apoptosis.Formula:C13H12O4Purity:98%Color and Shape:SolidMolecular weight:232.232-Phenyl-3-hydroxy-6,7-dihydro-furano-pyrone
CAS:2-Phenyl-3-hydroxy-6,7-dihydro-furano-pyrone is a synthetic compound that functions as a ligand for the ion channel TRPM8. This protein is selectively activated by cold temperatures, and it has been shown to be involved in pain perception. 2-Phenyl-3-hydroxy-6,7-dihydro-furano-pyrone binds to the TRPM8 receptor and activates it by increasing the flow of ions. It has been shown to inhibit the growth of cancer cells and can be used as a research tool for pharmacologists and biologists. 2--Phenyl--3--hydroxy--6,7--dihydro--furano--pyrone is available in high purity with CAS number 65408-91-5.Formula:C13H12O4Purity:Min. 95%Molecular weight:232.23 g/mol




