CymitQuimica logo

CAS 6542-44-5

:

(1S,4aR,11S,11aS,12aS)-3-acetyl-1-(dimethylamino)-4,4a,6,7,11-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydrotetracene-2,5(1H,4aH)-dione

Description:
The chemical substance with the name "(1S,4aR,11S,11aS,12aS)-3-acetyl-1-(dimethylamino)-4,4a,6,7,11-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydrotetracene-2,5(1H,4aH)-dione" and CAS number "6542-44-5" is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple hydroxyl groups and a dimethylamino functional group. This compound is notable for its potential biological activity, often studied in the context of medicinal chemistry and pharmacology. The presence of acetyl and hydroxyl groups suggests it may exhibit various chemical reactivities, including hydrogen bonding and potential interactions with biological macromolecules. Its stereochemistry, indicated by the specific configuration at multiple chiral centers, may influence its biological activity and interactions. As with many organic compounds, its solubility, stability, and reactivity can vary significantly depending on the solvent and environmental conditions. Further studies are typically required to elucidate its full range of properties and potential applications in research or industry.
Formula:C23H25NO8
InChI:InChI=1/C23H25NO8/c1-9(25)14-19(28)17(24(3)4)12-8-11-16(21(30)23(12,32)20(14)29)18(27)15-10(22(11,2)31)6-5-7-13(15)26/h5-7,11-12,17,26-27,29,31-32H,8H2,1-4H3/t11-,12-,17-,22+,23+/m0/s1
InChI key:VCGJFFLJLRZIHG-OIVQWWNTSA-N
SMILES:CC(=O)C1=C([C@@]2([C@@H](C[C@H]3C(=C(C4=C([C@@]3(C)O)C=CC=C4O)O)C2=O)[C@@H](C1=O)N(C)C)O)O
Found 7 products.