CAS 65423-56-5
:1-Bromo-3-(tert-butyldimethylsiloxy)benzene
Description:
1-Bromo-3-(tert-butyldimethylsiloxy)benzene is an organic compound characterized by the presence of a bromine atom and a tert-butyldimethylsiloxy group attached to a benzene ring. The bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications, particularly in electrophilic aromatic substitution reactions. The tert-butyldimethylsiloxy group serves as a protective group, providing stability and solubility, while also facilitating further functionalization of the aromatic system. This compound is generally non-volatile and exhibits moderate polarity due to the presence of the siloxy group. Its structure allows for potential applications in organic synthesis, particularly in the development of more complex molecules. Additionally, the presence of the siloxy group can influence the compound's physical properties, such as boiling point and solubility in organic solvents. As with many organobromine compounds, safety precautions should be observed due to potential toxicity and environmental concerns associated with brominated compounds.
Formula:C12H19BrOSi
InChI:InChI=1/C12H19BrOSi/c1-12(2,3)15(4,5)14-11-8-6-7-10(13)9-11/h6-9H,1-5H3
SMILES:CC(C)(C)[Si](C)(C)Oc1cccc(c1)Br
Synonyms:- 3-(tert-Butyldimethylsiloxy)bromobenzene
- (3-Bromophenoxy)(Tert-Butyl)Dimethylsilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-3-(tert-butyldimethylsiloxy)benzene, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C12H19BrOSiPurity:98+%Color and Shape:Clear colorless, LiquidMolecular weight:287.271-BROMO-3-(TERT-BUTYLDIMETHYLSILOXY)BENZENE
CAS:Formula:C12H19BrOSiPurity:98%Color and Shape:LiquidMolecular weight:287.2682(3-Bromophenoxy)-tert-butyl-dimethylsilane
CAS:(3-Bromophenoxy)-tert-butyl-dimethylsilanePurity:98%Molecular weight:287.27g/mol(3-Bromophenoxy)(tert-butyl)dimethylsilane
CAS:Formula:C12H19BrOSiPurity:98%Color and Shape:LiquidMolecular weight:287.272



