
CAS 6543-35-7
:N-[4-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]acetamide
Description:
N-[4-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]acetamide, with the CAS number 6543-35-7, is a chemical compound characterized by its complex structure, which includes an isoindole moiety and an acetamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. It may display moderate solubility in organic solvents and limited solubility in water, which is common for compounds with large aromatic systems. The presence of the dioxo group suggests potential reactivity, particularly in forming hydrogen bonds or participating in various chemical reactions. Additionally, compounds of this nature are often investigated for their pharmacological properties, including anti-inflammatory or anticancer activities, due to their structural similarities to known bioactive molecules. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would require further investigation.
Formula:C16H12N2O3
InChI:InChI=1S/C16H12N2O3/c1-10(19)17-11-6-8-12(9-7-11)18-15(20)13-4-2-3-5-14(13)16(18)21/h2-9H,1H3,(H,17,19)
InChI key:InChIKey=LOYJIHSAFJFQBK-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)C=2C1=CC=CC2)C3=CC=C(NC(C)=O)C=C3
Synonyms:- p-Phthalimidoacetanilide
- Acetamide, N-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]-
- N-[4-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]acetamide
- Acetanilide, 4′-phthalimido-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery