CAS 6543-57-3
:6H,12H,18H,24H-tetrabenzo[b,f,j,n][1,5,9,13]tetraoxacyclohexadecine-6,12,18,24-tetrone
Description:
The chemical substance known as "6H,12H,18H,24H-tetrabenzo[b,f,j,n][1,5,9,13]tetraoxacyclohexadecine-6,12,18,24-tetrone," with the CAS number 6543-57-3, is a complex polycyclic compound characterized by its unique tetracyclic structure that incorporates multiple benzene rings and oxygen functionalities. This compound features a tetraoxacyclohexadecine framework, indicating the presence of four oxygen atoms integrated into its cyclic structure, which contributes to its stability and reactivity. The presence of multiple carbonyl (C=O) groups, as suggested by the "tetrone" designation, implies that it may exhibit significant reactivity, particularly in nucleophilic addition reactions. The compound's intricate arrangement of aromatic systems may also impart interesting electronic properties, potentially making it useful in various applications, including organic electronics or as a dye. However, due to its complexity, detailed studies on its physical and chemical properties, such as solubility, melting point, and spectral characteristics, would be necessary to fully understand its behavior and potential applications in chemistry and materials science.
Formula:C28H16O8
InChI:InChI=1/C28H16O8/c29-25-17-9-1-5-13-21(17)33-26(30)19-11-3-7-15-23(19)35-28(32)20-12-4-8-16-24(20)36-27(31)18-10-2-6-14-22(18)34-25/h1-16H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Deferasirox Impurity 3
CAS:Formula:C28H16O8Color and Shape:White To Off-White SolidMolecular weight:480.43

