CAS 65445-61-6
:4-Chloro-N-nitrosopiperidine
Description:
4-Chloro-N-nitrosopiperidine is a chemical compound characterized by its nitrosamine structure, which is known for its potential carcinogenic properties. It features a piperidine ring, a six-membered saturated nitrogen-containing heterocycle, with a chlorine atom substituted at the fourth position and a nitroso group (-NO) attached to the nitrogen atom of the piperidine. This compound is typically a pale yellow to brown liquid or solid, depending on its purity and form. It is soluble in organic solvents but has limited solubility in water. The presence of the nitroso group contributes to its reactivity, making it susceptible to various chemical transformations. Due to its potential health risks, particularly in relation to cancer, 4-Chloro-N-nitrosopiperidine is handled with caution in laboratory settings, and its use is regulated in many jurisdictions. Proper safety measures, including the use of personal protective equipment and appropriate waste disposal methods, are essential when working with this compound.
Formula:C5H9ClN2O
InChI:InChI=1/C5H9ClN2O/c6-5-2-1-3-8(4-5)7-9/h5H,1-4H2
Synonyms:- Piperidine, 4-chloro-1-nitroso-
- 4-Chloro-1-nitrosopiperidine
- 4-Chloro-N-nitrosopiperidine
- 4-CHLORO-1-NITROSOPIPERDINE
- piperidine, 4-chloro-1-nitroso-
- 4-chloronitrosopiperidine
- N-Nitroso-4-chlor-piperidin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
