CAS 65445-62-7
:1-nitrosopiperidine-3-carboxylic acid
Description:
1-Nitrosopiperidine-3-carboxylic acid is a chemical compound characterized by its nitroso and carboxylic acid functional groups attached to a piperidine ring. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the nitroso group can impart unique reactivity, making it a subject of interest in various chemical reactions, including those involving nucleophiles. The carboxylic acid group contributes to its acidity and solubility in polar solvents. Additionally, compounds like 1-nitrosopiperidine-3-carboxylic acid may exhibit biological activity, which warrants careful handling due to potential toxicity. As with many nitroso compounds, it is essential to consider safety protocols during synthesis and use, as they can be hazardous. Overall, this compound serves as a valuable intermediate in the development of pharmaceuticals and other chemical products.
Formula:C6H10N2O3
InChI:InChI=1/C6H10N2O3/c9-6(10)5-2-1-3-8(4-5)7-11/h5H,1-4H2,(H,9,10)
SMILES:C1CC(CN(C1)N=O)C(=O)O
Synonyms:- 3-Piperidinecarboxylic Acid, 1-Nitroso-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
