CAS 654663-32-8

3-Methoxy-4-pyridinecarboxylic acid

Description:

3-Methoxy-4-pyridinecarboxylic acid, with the CAS number 654663-32-8, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxy group (-OCH3) and a carboxylic acid group (-COOH) attached to the pyridine ring, specifically at the 3 and 4 positions, respectively. The presence of these functional groups contributes to its polar nature, making it soluble in polar solvents like water and alcohols. It exhibits acidic properties due to the carboxylic acid group, which can donate protons in solution. The methoxy group can influence the compound's reactivity and stability, as well as its interaction with biological systems. 3-Methoxy-4-pyridinecarboxylic acid may be of interest in pharmaceutical research and synthesis due to its potential biological activity and role as a building block in the development of various chemical entities. Its structural characteristics and functional groups suggest potential applications in medicinal chemistry and agrochemicals.

Formula: C₇H₇NO₃

InChI: InChI=1/C7H7NO3/c1-11-6-4-8-3-2-5(6)7(9)10/h2-4H,1H3,(H,9,10)

SMILES: COc1cnccc1C(=O)O

3-Methoxyisonicotinic acid

CAS: 654663-32-8

Formula: C₇H₇NO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 153.1354

Ref: IN-DA0033QQ

3-Methoxyisonicotinic acid

CAS: 654663-32-8

3-Methoxyisonicotinic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.14g/mol

Ref: 54-OR313056

3-Methoxyisonicotinic acid

CAS: 654663-32-8

Formula: C₇H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.137

Ref: 10-F050213