CAS 65473-92-9: 1H-Pyrrole-3-carboxylic acid, 1,2-dimethyl-5-phenyl-

Description:1H-Pyrrole-3-carboxylic acid, 1,2-dimethyl-5-phenyl- is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylic acid functional group at the 3-position, contributing to its acidic properties. The presence of two methyl groups at the 1 and 2 positions and a phenyl group at the 5 position enhances its molecular complexity and can influence its reactivity and solubility. Generally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with various biological targets, and the presence of the carboxylic acid group can facilitate hydrogen bonding and solubility in polar solvents. Additionally, the compound's unique arrangement of substituents may impart specific physical properties, such as melting and boiling points, which are important for practical applications. Overall, 1H-Pyrrole-3-carboxylic acid, 1,2-dimethyl-5-phenyl- represents a class of compounds with diverse chemical behavior and potential utility in various fields.

Formula:C₁₃H₁₃NO₂

InChI:InChI=1S/C13H13NO2/c1-9-11(13(15)16)8-12(14(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,15,16)

InChI key:InChIKey=TWKHIBUROIJSPC-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=C(C=2C=CC=CC2)N(C1C)C