CAS 65474-39-7
:2-({[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetyl}oxy)benzoic acid
Description:
The chemical substance known as 2-({[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetyl}oxy)benzoic acid, with the CAS number 65474-39-7, is a complex organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features multiple functional groups, including an acetoxy group and a benzoic acid moiety, contributing to its potential biological activity. The presence of a 4-chlorobenzoyl group and a methoxy group enhances its lipophilicity and may influence its interaction with biological targets. The compound is likely to exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific biological activities, toxicity, and pharmacokinetics would require further investigation through empirical studies.
Formula:C26H20ClNO6
InChI:InChI=1/C26H20ClNO6/c1-15-20(14-24(29)34-23-6-4-3-5-19(23)26(31)32)21-13-18(33-2)11-12-22(21)28(15)25(30)16-7-9-17(27)10-8-16/h3-13H,14H2,1-2H3,(H,31,32)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Indomethacin salicylate
CAS:Indomethacin salicylate: anti-inflammatory drug; inhibits carrageenin edema, UV erythema, adjuvant arthritis.Formula:C26H20ClNO6Color and Shape:SolidMolecular weight:477.89
