CAS 65497-07-6
:Esculentoside A
Description:
Esculentoside A is a saponin compound primarily derived from the plant species *Dioscorea esculenta*, commonly known as the Chinese yam. This compound is characterized by its glycosidic structure, which consists of a sugar moiety linked to a steroid or triterpenoid aglycone. Esculentoside A exhibits various biological activities, including potential anti-inflammatory, antioxidant, and anticancer properties, making it of interest in pharmacological research. Its solubility in water is moderate due to the presence of sugar units, while its lipophilicity is influenced by the aglycone portion. The compound's structure contributes to its ability to interact with cell membranes, which may facilitate its bioactivity. Additionally, saponins like esculentoside A are known for their ability to form micelles, which can enhance the solubility and absorption of other compounds. Overall, esculentoside A represents a significant area of study in natural product chemistry and its potential therapeutic applications.
Formula:C42H66O16
InChI:InChI=1/C42H66O16/c1-37(36(53)54-6)11-13-42(35(51)52)14-12-40(4)20(21(42)15-37)7-8-26-38(2)16-22(45)32(39(3,19-44)25(38)9-10-41(26,40)5)56-24-18-55-33(30(49)28(24)47)58-34-31(50)29(48)27(46)23(17-43)57-34/h7,21-34,43-50H,8-19H2,1-6H3,(H,51,52)
InChI key:InChIKey=ZMXKPCHQLHYTHY-OWRBLJEPSA-N
SMILES:C[C@]12C([C@]3([C@@](C(O)=O)(CC1)CC[C@@](C(OC)=O)(C)C3)[H])=CC[C@]4([C@@]2(C)CC[C@@]5([C@]4(C)C[C@H](O)[C@H](O[C@H]6[C@H](O)[C@@H](O)[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)CO6)[C@]5(CO)C)[H])[H]
Synonyms:- (2b,3b,4a,20b)-3-((4-O-beta-D-Glucopyranosyl-beta-D-xylopyranosyl)oxy)-2,23-dihydroxyolean-12-ene-28,29-dioic acid 29-methyl ester
- 3-O-(4-O-β-<span class="text-smallcaps">D</smallcap>-Glucopyranosyl-β-<smallcap>D</span>-xylopyranosyl)phytolaccagenin
- 4-O-(2,23,28-trihydroxy-29-methoxy-28,29-dioxoolean-12-en-3-yl)pentopyranosyl hexopyranoside
- Olean-12-ene-28,29-dioic acid, 3-[(4-O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-xylopyranosyl)oxy]-2,23-dihydroxy-, 29-methyl ester, (2β,3β,4α,20β)-
- Phytolaccagenin, 3-(4-O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-xylopyranoside)
- Phytolaccasaponin E
- Phytolaccoside E
- Olean-12-ene-28,29-dioic acid, 3-[(4-O-β-D-glucopyranosyl-β-D-xylopyranosyl)oxy]-2,23-dihydroxy-, 29-methyl ester, (2β,3β,4α,20β)-
- Phytolaccagenin, 3-(4-O-β-D-glucopyranosyl-β-D-xylopyranoside)
- Esculentoside A
- Esculentoside A USP/EP/BP
- Esculentoside
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Olean-12-ene-28,29-dioic acid,3-[(4-O-b-D-glucopyranosyl-b-D-xylopyranosyl)oxy]-2,23-dihydroxy-,29-methyl ester, (2b,3b,4a,20b)-
CAS:Formula:C42H66O16Purity:95%Color and Shape:SolidMolecular weight:826.9638Esculentoside A
CAS:Esculentoside A dampens inflammation in ALI, modulates T cells, and could treat autoimmune diseases and BXSB mice by adjusting cytokines and renal cells.Formula:C42H66O16Purity:98% - 99.85%Color and Shape:SolidMolecular weight:826.96Esculentoside a
CAS:Natural glycosideFormula:C42H66O16Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:826.98Esculentoside A
CAS:Stability Hygroscopic
Applications Esculentoside A is a saponin isolated from the root of Phytolacca esculenta. Modulates the immune response. and effects cell proliferation and apoptosis in cells. Anti-inflammatory. 500
References Ma, H. et al.: Arch. Med. Sci., 9, 354 (2013); Zhong, W. et al.: J. Surg, Res., 185, 364 (2013);Formula:C42H66O16Color and Shape:Yellowish SolidMolecular weight:826.96Esculentoside A
CAS:Esculentoside A is a naturally occurring saponin, which is extracted from the roots of the plant *Phytolacca esculenta*. It is known for its significant anti-inflammatory and immune-modulatory effects. The mode of action of Esculentoside A involves the suppression of pro-inflammatory cytokine production and the inhibition of nuclear factor kappa B (NF-κB) signaling pathways. This contributes to its ability to attenuate inflammatory responses and modulate immune functions.Formula:C42H66O16Purity:Min. 95%Color and Shape:SolidMolecular weight:826.96 g/mol







