CAS 655-86-7
:2,3-Diaminophenazine
Description:
2,3-Diaminophenazine is an organic compound characterized by its structure, which features a phenazine core with two amino groups located at the 2 and 3 positions. This compound is typically a dark-colored solid, exhibiting properties associated with both aromatic and amine functionalities. It is known for its potential applications in various fields, including organic electronics, dyes, and as a precursor in the synthesis of other complex organic molecules. The presence of amino groups contributes to its reactivity, allowing for further functionalization and interaction with other chemical species. Additionally, 2,3-Diaminophenazine may exhibit interesting electrochemical properties, making it a subject of study in materials science and electrochemistry. Its solubility can vary depending on the solvent, and it may display distinct optical properties due to its conjugated system. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards.
Formula:C12H10N4
InChI:InChI=1S/C12H10N4/c13-7-5-11-12(6-8(7)14)16-10-4-2-1-3-9(10)15-11/h1-6H,13-14H2
InChI key:InChIKey=VZPGINJWPPHRLS-UHFFFAOYSA-N
SMILES:NC1=CC2=C(N=C3C(=N2)C=CC=C3)C=C1N
Synonyms:- 2,3-Diaminophenazine
- 2,3-Phenazinediamine
- Phenazine, 2,3-diamino-
- Phenazine-1,2-Diamine
- Phenazine-2,3-Diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Phenazine-2,3-diamine
CAS:Formula:C12H10N4Purity:>97.0%(HPLC)Color and Shape:Orange to Brown powder to crystalMolecular weight:210.24Ref: IN-DA003FGN
75gTo inquire100gTo inquire100mg27.00€250mg34.00€1g49.00€5g116.00€10g161.00€15g186.00€25g284.00€50g537.00€Phenazine-2,3-diamine
CAS:Phenazine-2,3-diamineFormula:C12H10N4Purity:95%Color and Shape: brown powderMolecular weight:210.23g/mol2,3-Diaminophenazine
CAS:2,3-Diaminophenazine, also known as 2,3-Phenazinediamine, is a phenazine derivative characterized by amino groups that exhibits notable luminescent,Formula:C12H10N4Color and Shape:SolidMolecular weight:210.232,3-Diaminophenazine
CAS:Controlled ProductFormula:C12H10N4Color and Shape:NeatMolecular weight:210.232,3-Diaminophenazine
CAS:2,3-Diaminophenazine is a fluorescent probe that is used for the detection of dopamine. 2,3-Diaminophenazine has been shown to be a good indicator of the presence of organic compounds in human serum. Research has also shown that 2,3-diaminophenazine can be used as a fluorescence probe for transport properties and transfer reactions. It is soluble in water and shows no evidence of toxicity or mutagenicity. 2,3-Diaminophenazine has been shown to react with copper ions to form a copper complex. This reaction solution can catalyze the enzyme catalysis of p-nitrophenyl phosphate to produce acid p-nitrophenol (pNP). The nitrogen atoms on 2,3-diaminophenazine are responsible for its ability to bind with copper ions and act as an electron acceptor at the electrode surface.Formula:C12H10N4Purity:Min 95%Molecular weight:210.23 g/mol








