CAS 65509-66-2
:Citatepine
Description:
Citatepine, with the CAS number 65509-66-2, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from plant sources and is known for its potential pharmacological properties. The compound exhibits a complex molecular structure, which contributes to its biological activity. Citatepine has been studied for its effects on various physiological processes, including its potential role in modulating neurotransmitter systems. Its solubility characteristics may vary depending on the solvent used, and it is typically analyzed using techniques such as chromatography and spectroscopy. While specific applications may vary, compounds like Citatepine are often explored for their therapeutic potential in treating conditions such as anxiety or depression. However, further research is necessary to fully understand its efficacy and safety profile. As with many chemical substances, proper handling and safety precautions are essential when working with Citatepine in laboratory settings.
Formula:C20H18N2S
InChI:InChI=1/C20H18N2S/c1-22-10-8-15-16(9-11-22)18-12-14(13-21)6-7-20(18)23-19-5-3-2-4-17(15)19/h2-7,12H,8-11H2,1H3
SMILES:CN1CCC2=C(CC1)c1cc(ccc1Sc1ccccc21)C#N
Synonyms:- Citatepine [INN]
- 2,3,4,5-Tetrahydro-3-methyl-1H-dibenzo(2,3:6,7)thiepino(4,5-d)azepine-7-carbonitrile
- Unii-92S48G7U0W
- 3-methyl-2,3,4,5-tetrahydro-1H-dibenzo[2,3:6,7]thiepino[4,5-d]azepine-7-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Citatepine
CAS:Citatepine is a tetracyclic dopamine antagonist acting strongly antidopaminergic opposed to antiserotonergic. Some anticholinergic activity.Formula:C20H18N2SColor and Shape:SolidMolecular weight:318.44

