CymitQuimica logo

CAS 65520-46-9

:

1,6-Bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] hexanedioate

Description:
1,6-Bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] hexanedioate, with CAS number 65520-46-9, is a chemical compound characterized by its complex structure, which includes a hexanedioate backbone and multiple ether linkages. This substance is typically used as a surfactant or emulsifier due to its amphiphilic nature, allowing it to interact with both hydrophilic and hydrophobic substances. The presence of butoxyethoxy groups contributes to its solubility in various organic solvents and enhances its ability to stabilize emulsions. It is often employed in formulations for personal care products, coatings, and industrial applications. The compound is generally considered to have low toxicity, but like many chemical substances, it should be handled with care, following appropriate safety guidelines. Its physical properties, such as boiling point, melting point, and specific gravity, can vary based on purity and formulation. Overall, 1,6-Bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] hexanedioate is valued for its functional versatility in various chemical applications.
Formula:C26H50O10
InChI:InChI=1S/C26H50O10/c1-3-5-11-29-13-15-31-17-19-33-21-23-35-25(27)9-7-8-10-26(28)36-24-22-34-20-18-32-16-14-30-12-6-4-2/h3-24H2,1-2H3
InChI key:InChIKey=NRUKYANAWUDQNY-UHFFFAOYSA-N
SMILES:C(CCCC(OCCOCCOCCOCCCC)=O)C(OCCOCCOCCOCCCC)=O
Synonyms:
  • Bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] adipate
  • Hexanedioic acid, 1,6-bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] ester
  • 1,6-Bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] hexanedioate
  • Nycoflex ADB 30
  • Hexanedioic acid, bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.