CAS 655235-50-0

3-bromo-2-tert-butyl-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine

Description:

3-bromo-2-tert-butyl-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a bromine atom and a chlorine atom, contributing to its reactivity and potential biological activity. The tert-butyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The presence of a trifluoromethyl group is notable for its electron-withdrawing properties, which can significantly affect the compound's electronic characteristics and reactivity. This compound is likely to exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique combination of halogen substituents and bulky groups may also impact its interactions with biological targets, potentially leading to applications in drug development. Overall, 3-bromo-2-tert-butyl-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine represents a structurally diverse compound with potential utility in various chemical and pharmaceutical contexts.

Formula: C₁₁H₁₀BrClF₃N₃

InChI: InChI=1/C11H10BrClF3N3/c1-10(2,3)8-7(12)9-17-5(11(14,15)16)4-6(13)19(9)18-8/h4H,1-3H3

SMILES: CC(C)(C)c1c(c2nc(cc(Cl)n2n1)C(F)(F)F)Br

Synonyms:

• Pyrazolo[1,5-A]Pyrimidine, 3-Bromo-7-Chloro-2-(1,1-Dimethylethyl)-5-(Trifluoromethyl)-
• 3-Bromo-2-tert-butyl-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine

3-bromo-2-(tert-butyl)-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine

CAS: 655235-50-0

3-bromo-2-(tert-butyl)-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine

Purity: 95%

Molecular weight: 356.57g/mol

Ref: 54-PC31849