CAS 655255-08-6

furo[3,2-d]pyrimidin-4(1H)-one

Description:

Furo[3,2-d]pyrimidin-4(1H)-one is a heterocyclic organic compound characterized by its fused ring structure, which includes a pyrimidine and a furan moiety. This compound typically exhibits a planar configuration due to the conjugated system, which can contribute to its potential biological activity. It is often studied for its pharmacological properties, as derivatives of pyrimidines are known to exhibit a range of activities, including antiviral, anticancer, and anti-inflammatory effects. The presence of the carbonyl group at the 4-position of the pyrimidine ring can enhance its reactivity and ability to form hydrogen bonds, which is significant in drug design. Additionally, the compound's solubility and stability can vary based on the substituents attached to the rings, influencing its interactions in biological systems. Overall, furo[3,2-d]pyrimidin-4(1H)-one represents a class of compounds with potential applications in medicinal chemistry and drug development.

Formula: C₆H₄N₂O₂

InChI: InChI=1/C6H4N2O2/c9-6-5-4(1-2-10-5)7-3-8-6/h1-3H,(H,7,8,9)

SMILES: c1coc2c1ncnc2O

Synonyms:

• Furo[3,2-d]pyrimidin-4(3H)-one

Furo[3,2-d]pyrimidin-4(1H)-one (9CI)

CAS: 655255-08-6

Formula: C₆H₄N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 136.1082

Ref: IN-DA006PGP

Furo[3,2-d]pyrimidin-4(3H)-one

CAS: 655255-08-6

Formula: C₆H₄N₂O₂

Purity: 95.0%

Molecular weight: 136.11

Ref: 10-F319457

Furo[3,2-d]pyrimidin-4(3H)-one

CAS: 655255-08-6

Furo[3,2-d]pyrimidin-4(3H)-one is a heterocyclic compound that has been reported to have anticoccidial properties. This compound has been shown to inhibit the growth of Eimeria tenella and Eimeria acervulina in vitro. Furo[3,2-d]pyrimidin-4(3H)-one also inhibits the synthesis of DNA in these protozoa.

Formula: C₆H₄N₂O₂

Purity: Min. 95%

Molecular weight: 136.11 g/mol

Ref: 3D-FBB25508